C22H35N2+ — CID 59952370
[4,5,6,7,8,9,10-heptamethyl-13-(methylamino)trideca-2,4,6,8,10,12-hexaenylidene]-methylazanium (PubChem CID 59952370) has the molecular formula C22H35N2+ and a molecular weight of 327.54 g/mol. Its IUPAC name is [4,5,6,7,8,9,10-heptamethyl-13-(methylamino)trideca-2,4,6,8,10,12-hexaenylidene]-methylazanium.
| Compound Name | [4,5,6,7,8,9,10-heptamethyl-13-(methylamino)trideca-2,4,6,8,10,12-hexaenylidene]-methylazanium |
|---|---|
| PubChem CID | 59952370 |
| Molecular Formula | C22H35N2+ |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.28 |
| IUPAC Name | [4,5,6,7,8,9,10-heptamethyl-13-(methylamino)trideca-2,4,6,8,10,12-hexaenylidene]-methylazanium |
| SMILES | CNC=CC=C(C)C(C)=C(C)C(C)=C(C)C(C)=C(C)C=C/C=[NH+]/C |
| InChI | InChI=1S/C22H34N2/c1-16(12-10-14-23-8)18(3)20(5)22(7)21(6)19(4)17(2)13-11-15-24-9/h10-15,23H,1-9H3/p+1/b13-11?,14-10?,16-12?,19-17?,20-18?,22-21?,24-15+ |
| InChIKey | GSYREMLDTANIEU-FEBJHASOSA-O |
| XLogP | 4.01 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|