C17H22N2 — CID 142583534
(2E,4Z,6E)-4-buta-1,3-dien-2-yl-N-methyl-6-(3H-pyrrol-4-yl)octa-2,4,6-trien-2-amine (PubChem CID 142583534) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (2E,4Z,6E)-4-buta-1,3-dien-2-yl-N-methyl-6-(3H-pyrrol-4-yl)octa-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z,6E)-4-buta-1,3-dien-2-yl-N-methyl-6-(3H-pyrrol-4-yl)octa-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 142583534 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (2E,4Z,6E)-4-buta-1,3-dien-2-yl-N-methyl-6-(3H-pyrrol-4-yl)octa-2,4,6-trien-2-amine |
| SMILES | C=CC(=C)C(=C/C(=C\C)C1=CN=CC1)/C=C(\C)NC |
| InChI | InChI=1S/C17H22N2/c1-6-13(3)17(10-14(4)18-5)11-15(7-2)16-8-9-19-12-16/h6-7,9-12,18H,1,3,8H2,2,4-5H3/b14-10+,15-7+,17-11- |
| InChIKey | WXYPECPKFVSNMH-HTZYYBSESA-N |
| XLogP | 4.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|