C14H23N3 — CID 134567726
(2E,5E)-N,3-dimethyl-4-methylimino-5-[(propan-2-ylideneamino)methylidene]hepta-2,6-dien-2-amine (PubChem CID 134567726) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is (2E,5E)-N,3-dimethyl-4-methylimino-5-[(propan-2-ylideneamino)methylidene]hepta-2,6-dien-2-amine.
| Compound Name | (2E,5E)-N,3-dimethyl-4-methylimino-5-[(propan-2-ylideneamino)methylidene]hepta-2,6-dien-2-amine |
|---|---|
| PubChem CID | 134567726 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (2E,5E)-N,3-dimethyl-4-methylimino-5-[(propan-2-ylideneamino)methylidene]hepta-2,6-dien-2-amine |
| SMILES | C=C/C(=C\N=C(C)C)C(=NC)/C(C)=C(\C)NC |
| InChI | InChI=1S/C14H23N3/c1-8-13(9-17-10(2)3)14(16-7)11(4)12(5)15-6/h8-9,15H,1H2,2-7H3/b12-11+,13-9+,16-14- |
| InChIKey | YJDONAJKPJYDJD-ZEIOPOBBSA-N |
| XLogP | 3.12 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|