C27H51N3 — CID 143756107
(Z)-but-2-ene;4-ethylheptane;(Z,4E)-3-methanimidoyl-N-methyl-4-[(3-methylbut-3-en-2-ylideneamino)methylidene]hex-2-en-1-amine (PubChem CID 143756107) has the molecular formula C27H51N3 and a molecular weight of 417.73 g/mol. Its IUPAC name is (Z)-but-2-ene;4-ethylheptane;(Z,4E)-3-methanimidoyl-N-methyl-4-[(3-methylbut-3-en-2-ylideneamino)methylidene]hex-2-en-1-amine.
| Compound Name | (Z)-but-2-ene;4-ethylheptane;(Z,4E)-3-methanimidoyl-N-methyl-4-[(3-methylbut-3-en-2-ylideneamino)methylidene]hex-2-en-1-amine |
|---|---|
| PubChem CID | 143756107 |
| Molecular Formula | C27H51N3 |
| Molecular Weight | 417.73 g/mol |
| Exact Mass | 417.41 |
| IUPAC Name | (Z)-but-2-ene;4-ethylheptane;(Z,4E)-3-methanimidoyl-N-methyl-4-[(3-methylbut-3-en-2-ylideneamino)methylidene]hex-2-en-1-amine |
| SMILES | C/C=C\C.CCCC(CC)CCC.[H]/N=C/C(=C\CNC)/C(=C/N=C(\C)C(=C)C)CC |
| InChI | InChI=1S/C14H23N3.C9H20.C4H8/c1-6-13(10-17-12(4)11(2)3)14(9-15)7-8-16-5;1-4-7-9(6-3)8-5-2;1-3-4-2/h7,9-10,15-16H,2,6,8H2,1,3-5H3;9H,4-8H2,1-3H3;3-4H,1-2H3/b13-10+,14-7+,15-9+,17-12+;;4-3- |
| InChIKey | NFUOCVZCLLOKSR-BFVURQINSA-N |
| XLogP | 8.31 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.73 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|