C29H58N2 — CID 145242404
(3Z,5Z)-3-(1-cyclopropylpropan-2-ylidene)-N-ethenylhepta-1,5-dien-4-imine;ethane;N-methylheptan-4-amine (PubChem CID 145242404) has the molecular formula C29H58N2 and a molecular weight of 434.80 g/mol. Its IUPAC name is (3Z,5Z)-3-(1-cyclopropylpropan-2-ylidene)-N-ethenylhepta-1,5-dien-4-imine;ethane;N-methylheptan-4-amine.
| Compound Name | (3Z,5Z)-3-(1-cyclopropylpropan-2-ylidene)-N-ethenylhepta-1,5-dien-4-imine;ethane;N-methylheptan-4-amine |
|---|---|
| PubChem CID | 145242404 |
| Molecular Formula | C29H58N2 |
| Molecular Weight | 434.80 g/mol |
| Exact Mass | 434.46 |
| IUPAC Name | (3Z,5Z)-3-(1-cyclopropylpropan-2-ylidene)-N-ethenylhepta-1,5-dien-4-imine;ethane;N-methylheptan-4-amine |
| SMILES | C=C/N=C(\C=C/C)C(/C=C)=C(/C)CC1CC1.CC.CC.CC.CCCC(CCC)NC |
| InChI | InChI=1S/C15H21N.C8H19N.3C2H6/c1-5-8-15(16-7-3)14(6-2)12(4)11-13-9-10-13;1-4-6-8(9-3)7-5-2;3*1-2/h5-8,13H,2-3,9-11H2,1,4H3;8-9H,4-7H2,1-3H3;3*1-2H3/b8-5-,14-12-,16-15+;;;; |
| InChIKey | FPUBTUIUQNMBMB-RTLZVOSWSA-N |
| XLogP | 9.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.80 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|