C18H33N3 — CID 166992131
(1Z,3E,7R)-3-butan-2-yl-5-ethyl-2-(ethyliminomethyl)nona-1,3,8-triene-1,7-diamine (PubChem CID 166992131) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is (1Z,3E,7R)-3-butan-2-yl-5-ethyl-2-(ethyliminomethyl)nona-1,3,8-triene-1,7-diamine.
| Compound Name | (1Z,3E,7R)-3-butan-2-yl-5-ethyl-2-(ethyliminomethyl)nona-1,3,8-triene-1,7-diamine |
|---|---|
| PubChem CID | 166992131 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | (1Z,3E,7R)-3-butan-2-yl-5-ethyl-2-(ethyliminomethyl)nona-1,3,8-triene-1,7-diamine |
| SMILES | C=C[C@H](N)CC(/C=C(C(=C/N)/C=N/CC)\C(C)CC)CC |
| InChI | InChI=1S/C18H33N3/c1-6-14(5)18(16(12-19)13-21-9-4)11-15(7-2)10-17(20)8-3/h8,11-15,17H,3,6-7,9-10,19-20H2,1-2,4-5H3/b16-12+,18-11+,21-13+/t14?,15?,17-/m0/s1 |
| InChIKey | NDMDCJLGKSJFJO-KPUDLYLZSA-N |
| XLogP | 3.82 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|