C11H19N3 — CID 163708550
(5S)-4-[(1R)-1-amino-2-ethyliminoethyl]-5-methylcyclohexa-1,3-dien-1-amine (PubChem CID 163708550) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (5S)-4-[(1R)-1-amino-2-ethyliminoethyl]-5-methylcyclohexa-1,3-dien-1-amine.
| Compound Name | (5S)-4-[(1R)-1-amino-2-ethyliminoethyl]-5-methylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163708550 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (5S)-4-[(1R)-1-amino-2-ethyliminoethyl]-5-methylcyclohexa-1,3-dien-1-amine |
| SMILES | CC/N=C/[C@H](N)C1=CC=C(N)C[C@@H]1C |
| InChI | InChI=1S/C11H19N3/c1-3-14-7-11(13)10-5-4-9(12)6-8(10)2/h4-5,7-8,11H,3,6,12-13H2,1-2H3/b14-7+/t8-,11-/m0/s1 |
| InChIKey | KHEPJIWSIDYSPS-BCZIDPNWSA-N |
| XLogP | 1.21 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|