C17H36N2 — CID 163243171
N,2-dimethylprop-2-en-1-imine;(Z)-3-methyloct-5-en-1-amine;propane (PubChem CID 163243171) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is N,2-dimethylprop-2-en-1-imine;(Z)-3-methyloct-5-en-1-amine;propane.
| Compound Name | N,2-dimethylprop-2-en-1-imine;(Z)-3-methyloct-5-en-1-amine;propane |
|---|---|
| PubChem CID | 163243171 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | N,2-dimethylprop-2-en-1-imine;(Z)-3-methyloct-5-en-1-amine;propane |
| SMILES | C=C(C)/C=N/C.CC/C=C\CC(C)CCN.CCC |
| InChI | InChI=1S/C9H19N.C5H9N.C3H8/c1-3-4-5-6-9(2)7-8-10;1-5(2)4-6-3;1-3-2/h4-5,9H,3,6-8,10H2,1-2H3;4H,1H2,2-3H3;3H2,1-2H3/b5-4-;6-4+; |
| InChIKey | DJODYZMZCYPGAZ-PASZOPLDSA-N |
| XLogP | 5.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|