C12H23N2+ — CID 163819994
[(E)-4-(2-aminoethyl)-6-methyloct-6-enylidene]-methylideneazanium (PubChem CID 163819994) has the molecular formula C12H23N2+ and a molecular weight of 195.33 g/mol. Its IUPAC name is [(E)-4-(2-aminoethyl)-6-methyloct-6-enylidene]-methylideneazanium.
| Compound Name | [(E)-4-(2-aminoethyl)-6-methyloct-6-enylidene]-methylideneazanium |
|---|---|
| PubChem CID | 163819994 |
| Molecular Formula | C12H23N2+ |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.19 |
| IUPAC Name | [(E)-4-(2-aminoethyl)-6-methyloct-6-enylidene]-methylideneazanium |
| SMILES | C=[N+]=CCCC(CCN)C/C(C)=C/C |
| InChI | InChI=1S/C12H23N2/c1-4-11(2)10-12(7-8-13)6-5-9-14-3/h4,9,12H,3,5-8,10,13H2,1-2H3/q+1/b11-4+ |
| InChIKey | RWYHCPWNQWJYKV-NYYWCZLTSA-N |
| XLogP | 1.93 |
| TPSA | 40.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|