C13H23N2+ — CID 123729644
4-[2-(3,4-dihydropyrrol-1-ium-3-yl)ethyl]hept-3-en-2-amine (PubChem CID 123729644) has the molecular formula C13H23N2+ and a molecular weight of 207.34 g/mol. Its IUPAC name is 4-[2-(3,4-dihydropyrrol-1-ium-3-yl)ethyl]hept-3-en-2-amine.
| Compound Name | 4-[2-(3,4-dihydropyrrol-1-ium-3-yl)ethyl]hept-3-en-2-amine |
|---|---|
| PubChem CID | 123729644 |
| Molecular Formula | C13H23N2+ |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.19 |
| IUPAC Name | 4-[2-(3,4-dihydropyrrol-1-ium-3-yl)ethyl]hept-3-en-2-amine |
| SMILES | CCCC(=CC(C)N)CCC1C=[N+]=CC1 |
| InChI | InChI=1S/C13H23N2/c1-3-4-12(9-11(2)14)5-6-13-7-8-15-10-13/h8-11,13H,3-7,14H2,1-2H3/q+1 |
| InChIKey | NCJPKMQPEHKHSH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|