C10H18N2 — CID 87603732
(2E)-2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine (PubChem CID 87603732) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (2E)-2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine.
| Compound Name | (2E)-2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine |
|---|---|
| PubChem CID | 87603732 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (2E)-2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine |
| SMILES | C/N=C(\C)C1CCC/C1=C\CN |
| InChI | InChI=1S/C10H18N2/c1-8(12-2)10-5-3-4-9(10)6-7-11/h6,10H,3-5,7,11H2,1-2H3/b9-6+,12-8+ |
| InChIKey | PQCUSURIYMULDQ-JCJUGQDJSA-N |
| XLogP | 1.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|