C14H26N2 — CID 146254087
(2E,6E)-3,7-dimethyl-10-methyliminoundeca-2,6-dien-1-amine (PubChem CID 146254087) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (2E,6E)-3,7-dimethyl-10-methyliminoundeca-2,6-dien-1-amine.
| Compound Name | (2E,6E)-3,7-dimethyl-10-methyliminoundeca-2,6-dien-1-amine |
|---|---|
| PubChem CID | 146254087 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (2E,6E)-3,7-dimethyl-10-methyliminoundeca-2,6-dien-1-amine |
| SMILES | C/N=C(\C)CC/C(C)=C/CC/C(C)=C/CN |
| InChI | InChI=1S/C14H26N2/c1-12(8-9-14(3)16-4)6-5-7-13(2)10-11-15/h6,10H,5,7-9,11,15H2,1-4H3/b12-6+,13-10+,16-14+ |
| InChIKey | XIAGECXQZUULBY-LLCAYLNRSA-N |
| XLogP | 3.49 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|