C21H34N2 — CID 123742269
(4Z)-4-ethyl-2-N-(3-methylpent-2-enyl)-5-(2-methylprop-2-enyl)nona-4,7-diene-2,3-diimine (PubChem CID 123742269) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is (4Z)-4-ethyl-2-N-(3-methylpent-2-enyl)-5-(2-methylprop-2-enyl)nona-4,7-diene-2,3-diimine.
| Compound Name | (4Z)-4-ethyl-2-N-(3-methylpent-2-enyl)-5-(2-methylprop-2-enyl)nona-4,7-diene-2,3-diimine |
|---|---|
| PubChem CID | 123742269 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | (4Z)-4-ethyl-2-N-(3-methylpent-2-enyl)-5-(2-methylprop-2-enyl)nona-4,7-diene-2,3-diimine |
| SMILES | [H]/N=C(C(/CC)=C(/CC=CC)CC(=C)C)\C(C)=N\CC=C(C)CC |
| InChI | InChI=1S/C21H34N2/c1-8-11-12-19(15-16(4)5)20(10-3)21(22)18(7)23-14-13-17(6)9-2/h8,11,13,22H,4,9-10,12,14-15H2,1-3,5-7H3/b11-8?,17-13?,20-19-,22-21+,23-18+ |
| InChIKey | UJTHGXVASHPBLA-HHKGCJPASA-N |
| XLogP | 6.46 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|