C17H28N2 — CID 123764237
2-[2-(2,4-dimethylhex-2-enylimino)propyl]cyclohex-2-en-1-imine (PubChem CID 123764237) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylhex-2-enylimino)propyl]cyclohex-2-en-1-imine.
| Compound Name | 2-[2-(2,4-dimethylhex-2-enylimino)propyl]cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123764237 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 2-[2-(2,4-dimethylhex-2-enylimino)propyl]cyclohex-2-en-1-imine |
| SMILES | [H]/N=C1\CCCC=C1C/C(C)=N/CC(C)=CC(C)CC |
| InChI | InChI=1S/C17H28N2/c1-5-13(2)10-14(3)12-19-15(4)11-16-8-6-7-9-17(16)18/h8,10,13,18H,5-7,9,11-12H2,1-4H3/b14-10?,18-17+,19-15+ |
| InChIKey | DEXLDWDQOIEYTR-AOKFJTDQSA-N |
| XLogP | 4.96 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|