C31H50N2 — CID 123267723
(3Z)-9-methyl-2-N-(4-methyldeca-2,3,8-trienyl)nonadeca-3,9,18-triene-2,14-diimine (PubChem CID 123267723) has the molecular formula C31H50N2 and a molecular weight of 450.76 g/mol. Its IUPAC name is (3Z)-9-methyl-2-N-(4-methyldeca-2,3,8-trienyl)nonadeca-3,9,18-triene-2,14-diimine.
| Compound Name | (3Z)-9-methyl-2-N-(4-methyldeca-2,3,8-trienyl)nonadeca-3,9,18-triene-2,14-diimine |
|---|---|
| PubChem CID | 123267723 |
| Molecular Formula | C31H50N2 |
| Molecular Weight | 450.76 g/mol |
| Exact Mass | 450.40 |
| IUPAC Name | (3Z)-9-methyl-2-N-(4-methyldeca-2,3,8-trienyl)nonadeca-3,9,18-triene-2,14-diimine |
| SMILES | [H]/N=C(\CCCC=C)CCCC=C(C)CCCC/C=C\C(C)=N\CC=C=C(C)CCCC=CC |
| InChI | InChI=1S/C31H50N2/c1-6-8-10-14-20-29(4)23-19-27-33-30(5)24-16-12-11-15-21-28(3)22-17-18-26-31(32)25-13-9-7-2/h6-8,16,19,22,24,32H,2,9-15,17-18,20-21,25-27H2,1,3-5H3/b8-6?,24-16-,28-22?,32-31+,33-30+ |
| InChIKey | RRUXQPKSQMLDAB-SELNSSJISA-N |
| XLogP | 9.90 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.76 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|