C14H24N2 — CID 123272950
(3Z,6Z)-3,6-di(ethylidene)-2-N,7-N-dimethyloctane-2,7-diimine (PubChem CID 123272950) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (3Z,6Z)-3,6-di(ethylidene)-2-N,7-N-dimethyloctane-2,7-diimine.
| Compound Name | (3Z,6Z)-3,6-di(ethylidene)-2-N,7-N-dimethyloctane-2,7-diimine |
|---|---|
| PubChem CID | 123272950 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (3Z,6Z)-3,6-di(ethylidene)-2-N,7-N-dimethyloctane-2,7-diimine |
| SMILES | C/C=C(CCC(=C/C)/C(C)=N/C)\C(C)=N\C |
| InChI | InChI=1S/C14H24N2/c1-7-13(11(3)15-5)9-10-14(8-2)12(4)16-6/h7-8H,9-10H2,1-6H3/b13-7-,14-8-,15-11+,16-12+ |
| InChIKey | JSFFADRRZBQGOQ-YCHNUKPBSA-N |
| XLogP | 3.84 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|