C23H35N3 — CID 123916041
(2E,5Z)-1-[2-[(E)-hept-2-enimidoyl]cycloocten-1-yl]octa-2,5-diene-1,8-diimine (PubChem CID 123916041) has the molecular formula C23H35N3 and a molecular weight of 353.55 g/mol. Its IUPAC name is (2E,5Z)-1-[2-[(E)-hept-2-enimidoyl]cycloocten-1-yl]octa-2,5-diene-1,8-diimine.
| Compound Name | (2E,5Z)-1-[2-[(E)-hept-2-enimidoyl]cycloocten-1-yl]octa-2,5-diene-1,8-diimine |
|---|---|
| PubChem CID | 123916041 |
| Molecular Formula | C23H35N3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.28 |
| IUPAC Name | (2E,5Z)-1-[2-[(E)-hept-2-enimidoyl]cycloocten-1-yl]octa-2,5-diene-1,8-diimine |
| SMILES | [H]/N=C/C/C=C\C/C=C/C(=N\[H])C1=C(C(/C=C/CCCC)=N/[H])CCCCCC1 |
| InChI | InChI=1S/C23H35N3/c1-2-3-4-12-17-22(25)20-15-10-7-8-11-16-21(20)23(26)18-13-6-5-9-14-19-24/h5,9,12-13,17-19,24-26H,2-4,6-8,10-11,14-16H2,1H3/b9-5-,17-12+,18-13+,21-20?,24-19+,25-22+,26-23+ |
| InChIKey | FDBNELDHPJUFKQ-XOZZXIQISA-N |
| XLogP | 6.97 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|