C23H36N2 — CID 123863376
(Z,5Z)-N-[(Z)-cyclohexa-1,3-dien-1-ylmethylideneamino]-6-ethyltetradeca-2,5-dien-7-imine (PubChem CID 123863376) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is (Z,5Z)-N-[(Z)-cyclohexa-1,3-dien-1-ylmethylideneamino]-6-ethyltetradeca-2,5-dien-7-imine.
| Compound Name | (Z,5Z)-N-[(Z)-cyclohexa-1,3-dien-1-ylmethylideneamino]-6-ethyltetradeca-2,5-dien-7-imine |
|---|---|
| PubChem CID | 123863376 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | (Z,5Z)-N-[(Z)-cyclohexa-1,3-dien-1-ylmethylideneamino]-6-ethyltetradeca-2,5-dien-7-imine |
| SMILES | CC=CC/C=C(CC)\C(CCCCCCC)=N/N=C\C1=CC=CCC1 |
| InChI | InChI=1S/C23H36N2/c1-4-7-9-10-15-19-23(22(6-3)18-12-8-5-2)25-24-20-21-16-13-11-14-17-21/h5,8,11,13,16,18,20H,4,6-7,9-10,12,14-15,17,19H2,1-3H3/b8-5?,22-18-,24-20-,25-23- |
| InChIKey | AQBHDBIKIQLJAJ-KVTVLTOTSA-N |
| XLogP | 7.35 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|