C12H18N2 — CID 90817774
(E,4Z)-6-methyl-3-methylidene-N-[(E)-propylideneamino]hepta-4,6-dien-2-imine (PubChem CID 90817774) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (E,4Z)-6-methyl-3-methylidene-N-[(E)-propylideneamino]hepta-4,6-dien-2-imine.
| Compound Name | (E,4Z)-6-methyl-3-methylidene-N-[(E)-propylideneamino]hepta-4,6-dien-2-imine |
|---|---|
| PubChem CID | 90817774 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (E,4Z)-6-methyl-3-methylidene-N-[(E)-propylideneamino]hepta-4,6-dien-2-imine |
| SMILES | C=C(C)/C=C\C(=C)/C(C)=N/N=C/CC |
| InChI | InChI=1S/C12H18N2/c1-6-9-13-14-12(5)11(4)8-7-10(2)3/h7-9H,2,4,6H2,1,3,5H3/b8-7-,13-9+,14-12- |
| InChIKey | UEFIESOTYAAUGO-ZMOYFTJTSA-N |
| XLogP | 3.53 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|