C16H28N2 — CID 123758535
7-N-ethylidene-9,10-dimethyldodeca-1,9-diene-5,7-diimine (PubChem CID 123758535) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 7-N-ethylidene-9,10-dimethyldodeca-1,9-diene-5,7-diimine.
| Compound Name | 7-N-ethylidene-9,10-dimethyldodeca-1,9-diene-5,7-diimine |
|---|---|
| PubChem CID | 123758535 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 7-N-ethylidene-9,10-dimethyldodeca-1,9-diene-5,7-diimine |
| SMILES | [H]/N=C(\CCC=C)CC(CC(C)=C(C)CC)/N=C/C |
| InChI | InChI=1S/C16H28N2/c1-6-9-10-15(17)12-16(18-8-3)11-14(5)13(4)7-2/h6,8,16-17H,1,7,9-12H2,2-5H3/b14-13?,17-15+,18-8+ |
| InChIKey | AWOPSVJBNLFVTL-BLIWQVQYSA-N |
| XLogP | 4.96 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|