C17H30N2 — CID 163540229
(2S)-N-methyl-1-[(2S,8E)-4-methylidenedodeca-8,11-dien-2-yl]iminopropan-2-amine (PubChem CID 163540229) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is (2S)-N-methyl-1-[(2S,8E)-4-methylidenedodeca-8,11-dien-2-yl]iminopropan-2-amine.
| Compound Name | (2S)-N-methyl-1-[(2S,8E)-4-methylidenedodeca-8,11-dien-2-yl]iminopropan-2-amine |
|---|---|
| PubChem CID | 163540229 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | (2S)-N-methyl-1-[(2S,8E)-4-methylidenedodeca-8,11-dien-2-yl]iminopropan-2-amine |
| SMILES | C=CC/C=C/CCCC(=C)C[C@H](C)/N=C/[C@H](C)NC |
| InChI | InChI=1S/C17H30N2/c1-6-7-8-9-10-11-12-15(2)13-16(3)19-14-17(4)18-5/h6,8-9,14,16-18H,1-2,7,10-13H2,3-5H3/b9-8+,19-14+/t16-,17-/m0/s1 |
| InChIKey | FAMLGSIBNOAAAJ-AQYRVQIASA-N |
| XLogP | 4.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|