About 5-(2,3-dihydropyridin-2-yl)pentan-2-amine
5-(2,3-dihydropyridin-2-yl)pentan-2-amine (PubChem CID 67896760) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 5-(2,3-dihydropyridin-2-yl)pentan-2-amine.
Molecular Properties
| Compound Name | 5-(2,3-dihydropyridin-2-yl)pentan-2-amine |
| PubChem CID | 67896760 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 5-(2,3-dihydropyridin-2-yl)pentan-2-amine |
| SMILES | CC(N)CCCC1CC=CC=N1 |
| InChI | InChI=1S/C10H18N2/c1-9(11)5-4-7-10-6-2-3-8-12-10/h2-3,8-10H,4-7,11H2,1H3 |
| InChIKey | JKEVZUHJODBYGR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,3-dihydropyridin-2-yl)pentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dihydropyridin-2-yl)pentan-2-amine?
The IUPAC name of 5-(2,3-dihydropyridin-2-yl)pentan-2-amine (CID 67896760) is 5-(2,3-dihydropyridin-2-yl)pentan-2-amine.
What is the SMILES notation for 5-(2,3-dihydropyridin-2-yl)pentan-2-amine?
The canonical SMILES for 5-(2,3-dihydropyridin-2-yl)pentan-2-amine is CC(N)CCCC1CC=CC=N1.
What is the InChIKey of 5-(2,3-dihydropyridin-2-yl)pentan-2-amine?
The InChIKey is JKEVZUHJODBYGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-9(11)5-4-7-10-6-2-3-8-12-10/h2-3,8-10H,4-7,11H2,1H3.
What are the key properties of 5-(2,3-dihydropyridin-2-yl)pentan-2-amine?
5-(2,3-dihydropyridin-2-yl)pentan-2-amine has a molecular weight of 166.27 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydropyridin-2-yl)pentan-2-amine is sourced from PubChem (CID 67896760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).