C10H18N2 — CID 67896766
2-pentyl-2,3-dihydropyridin-3-amine (PubChem CID 67896766) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 2-pentyl-2,3-dihydropyridin-3-amine.
| Compound Name | 2-pentyl-2,3-dihydropyridin-3-amine |
|---|---|
| PubChem CID | 67896766 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 2-pentyl-2,3-dihydropyridin-3-amine |
| SMILES | CCCCCC1N=CC=CC1N |
| InChI | InChI=1S/C10H18N2/c1-2-3-4-7-10-9(11)6-5-8-12-10/h5-6,8-10H,2-4,7,11H2,1H3 |
| InChIKey | LQISZZWRMFZJJK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|