C11H22N2S — CID 67622840
(2S,3R,4R)-3-methyl-4-methylsulfanyl-2-pentyl-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 67622840) has the molecular formula C11H22N2S and a molecular weight of 214.38 g/mol. Its IUPAC name is (2S,3R,4R)-3-methyl-4-methylsulfanyl-2-pentyl-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | (2S,3R,4R)-3-methyl-4-methylsulfanyl-2-pentyl-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 67622840 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (2S,3R,4R)-3-methyl-4-methylsulfanyl-2-pentyl-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CCCCC[C@@H]1N=C(N)[C@H](SC)[C@@H]1C |
| InChI | InChI=1S/C11H22N2S/c1-4-5-6-7-9-8(2)10(14-3)11(12)13-9/h8-10H,4-7H2,1-3H3,(H2,12,13)/t8-,9+,10-/m1/s1 |
| InChIKey | BESHELCLUDUVMS-KXUCPTDWSA-N |
| XLogP | 2.67 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|