C14H20N2 — CID 90723422
3-butyl-5-methyl-4-phenyl-4,5-dihydro-3H-pyrazole (PubChem CID 90723422) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 3-butyl-5-methyl-4-phenyl-4,5-dihydro-3H-pyrazole.
| Compound Name | 3-butyl-5-methyl-4-phenyl-4,5-dihydro-3H-pyrazole |
|---|---|
| PubChem CID | 90723422 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3-butyl-5-methyl-4-phenyl-4,5-dihydro-3H-pyrazole |
| SMILES | CCCCC1N=NC(C)C1c1ccccc1 |
| InChI | InChI=1S/C14H20N2/c1-3-4-10-13-14(11(2)15-16-13)12-8-6-5-7-9-12/h5-9,11,13-14H,3-4,10H2,1-2H3 |
| InChIKey | JVQVOOGRJQTZDQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |