C22H29OSi+ — CID 135036107
[(3R)-2,5-dimethyl-3,4-diphenylcyclopentyl]oxy-trimethylsilane (PubChem CID 135036107) has the molecular formula C22H29OSi+ and a molecular weight of 337.56 g/mol. Its IUPAC name is [(3R)-2,5-dimethyl-3,4-diphenylcyclopentyl]oxy-trimethylsilane.
| Compound Name | [(3R)-2,5-dimethyl-3,4-diphenylcyclopentyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 135036107 |
| Molecular Formula | C22H29OSi+ |
| Molecular Weight | 337.56 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | [(3R)-2,5-dimethyl-3,4-diphenylcyclopentyl]oxy-trimethylsilane |
| SMILES | CC1[C+](O[Si](C)(C)C)C(C)[C@H](c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C22H29OSi/c1-16-20(18-12-8-6-9-13-18)21(19-14-10-7-11-15-19)17(2)22(16)23-24(3,4)5/h6-17,20-21H,1-5H3/q+1/t16?,17?,20-,21?/m1/s1 |
| InChIKey | PZJOLTXLGOQUFH-IDBGYDNBSA-N |
| XLogP | 6.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|