C24H40Sn — CID 10837130
tributyl-[(1S,2R,3S)-2-phenyl-3-prop-2-enylcyclopropyl]stannane (PubChem CID 10837130) has the molecular formula C24H40Sn and a molecular weight of 447.30 g/mol. Its IUPAC name is tributyl-[(1S,2R,3S)-2-phenyl-3-prop-2-enylcyclopropyl]stannane.
| Compound Name | tributyl-[(1S,2R,3S)-2-phenyl-3-prop-2-enylcyclopropyl]stannane |
|---|---|
| PubChem CID | 10837130 |
| Molecular Formula | C24H40Sn |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | tributyl-[(1S,2R,3S)-2-phenyl-3-prop-2-enylcyclopropyl]stannane |
| SMILES | C=CC[C@H]1[C@H](c2ccccc2)[C@H]1[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C12H13.3C4H9.Sn/c1-2-6-11-9-12(11)10-7-4-3-5-8-10;3*1-3-4-2;/h2-5,7-9,11-12H,1,6H2;3*1,3-4H2,2H3;/t11-,12+;;;;/m1..../s1 |
| InChIKey | ATTMCQFOXYOBFH-PWAPIHSDSA-N |
| XLogP | 8.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|