C17H24N2 — CID 70421914
N-benzyl-2-pentyl-2,3-dihydropyridin-3-amine (PubChem CID 70421914) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N-benzyl-2-pentyl-2,3-dihydropyridin-3-amine.
| Compound Name | N-benzyl-2-pentyl-2,3-dihydropyridin-3-amine |
|---|---|
| PubChem CID | 70421914 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N-benzyl-2-pentyl-2,3-dihydropyridin-3-amine |
| SMILES | CCCCCC1N=CC=CC1NCc1ccccc1 |
| InChI | InChI=1S/C17H24N2/c1-2-3-5-11-16-17(12-8-13-18-16)19-14-15-9-6-4-7-10-15/h4,6-10,12-13,16-17,19H,2-3,5,11,14H2,1H3 |
| InChIKey | QUICKUBAZYWJTR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|