C10H20N2O — CID 57241657
5-amino-4-methyl-2-pentyl-3,4-dihydro-2H-pyrrol-3-ol (PubChem CID 57241657) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 5-amino-4-methyl-2-pentyl-3,4-dihydro-2H-pyrrol-3-ol.
| Compound Name | 5-amino-4-methyl-2-pentyl-3,4-dihydro-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 57241657 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 5-amino-4-methyl-2-pentyl-3,4-dihydro-2H-pyrrol-3-ol |
| SMILES | CCCCCC1N=C(N)C(C)C1O |
| InChI | InChI=1S/C10H20N2O/c1-3-4-5-6-8-9(13)7(2)10(11)12-8/h7-9,13H,3-6H2,1-2H3,(H2,11,12) |
| InChIKey | KSRMNCKMKAKMDA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|