C14H26N2 — CID 70625505
1,2-dibutyl-2,3-dihydroazepin-3-amine (PubChem CID 70625505) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 1,2-dibutyl-2,3-dihydroazepin-3-amine.
| Compound Name | 1,2-dibutyl-2,3-dihydroazepin-3-amine |
|---|---|
| PubChem CID | 70625505 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1,2-dibutyl-2,3-dihydroazepin-3-amine |
| SMILES | CCCCC1C(N)C=CC=CN1CCCC |
| InChI | InChI=1S/C14H26N2/c1-3-5-10-14-13(15)9-7-8-12-16(14)11-6-4-2/h7-9,12-14H,3-6,10-11,15H2,1-2H3 |
| InChIKey | DYNLTTGAHKBWTF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |