C12H19NO2 — CID 162720512
2-(1-pentyl-2H-pyridin-2-yl)acetic acid (PubChem CID 162720512) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(1-pentyl-2H-pyridin-2-yl)acetic acid.
| Compound Name | 2-(1-pentyl-2H-pyridin-2-yl)acetic acid |
|---|---|
| PubChem CID | 162720512 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-(1-pentyl-2H-pyridin-2-yl)acetic acid |
| SMILES | CCCCCN1C=CC=CC1CC(=O)O |
| InChI | InChI=1S/C12H19NO2/c1-2-3-5-8-13-9-6-4-7-11(13)10-12(14)15/h4,6-7,9,11H,2-3,5,8,10H2,1H3,(H,14,15) |
| InChIKey | BTYBXEGTUYCOAD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|