C9H14N2 — CID 123906403
3-N,5-dimethylcyclohept-4-ene-1,3-diimine (PubChem CID 123906403) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-N,5-dimethylcyclohept-4-ene-1,3-diimine.
| Compound Name | 3-N,5-dimethylcyclohept-4-ene-1,3-diimine |
|---|---|
| PubChem CID | 123906403 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3-N,5-dimethylcyclohept-4-ene-1,3-diimine |
| SMILES | [H]/N=C1\CCC(C)=C/C(=N/C)C1 |
| InChI | InChI=1S/C9H14N2/c1-7-3-4-8(10)6-9(5-7)11-2/h5,10H,3-4,6H2,1-2H3/b10-8+,11-9- |
| InChIKey | HFCSALMFYDVCEM-GOOGBFEESA-N |
| XLogP | 2.21 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|