C9H16N2 — CID 123398859
4-N,6-dimethylhept-5-ene-3,4-diimine (PubChem CID 123398859) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 4-N,6-dimethylhept-5-ene-3,4-diimine.
| Compound Name | 4-N,6-dimethylhept-5-ene-3,4-diimine |
|---|---|
| PubChem CID | 123398859 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 4-N,6-dimethylhept-5-ene-3,4-diimine |
| SMILES | [H]/N=C(CC)/C(C=C(C)C)=N/C |
| InChI | InChI=1S/C9H16N2/c1-5-8(10)9(11-4)6-7(2)3/h6,10H,5H2,1-4H3/b10-8+,11-9+ |
| InChIKey | HEJKHAFYTKTWBJ-GFULKKFKSA-N |
| XLogP | 2.45 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|