C9H12N2 — CID 123632189
4-N-ethyl-2-methylcyclohexa-2,5-diene-1,4-diimine (PubChem CID 123632189) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 4-N-ethyl-2-methylcyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 4-N-ethyl-2-methylcyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 123632189 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 4-N-ethyl-2-methylcyclohexa-2,5-diene-1,4-diimine |
| SMILES | [H]/N=C1\C=C/C(=N\CC)C=C1C |
| InChI | InChI=1S/C9H12N2/c1-3-11-8-4-5-9(10)7(2)6-8/h4-6,10H,3H2,1-2H3/b10-9+,11-8+ |
| InChIKey | UVCXRKADJMBHEJ-RUFFMTGISA-N |
| XLogP | 1.98 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|