C7H8N2 — CID 59789006
2-N-methylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 59789006) has the molecular formula C7H8N2 and a molecular weight of 120.15 g/mol. Its IUPAC name is 2-N-methylcyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 2-N-methylcyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 59789006 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 2-N-methylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1\C=CC=C\C1=N/C |
| InChI | InChI=1S/C7H8N2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3/b8-6+,9-7+ |
| InChIKey | XMQMAVYBUSIYMM-CDJQDVQCSA-N |
| XLogP | 1.20 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|