C24H39N3 — CID 91069167
5-but-3-en-2-yl-8-hepta-2,6-dienylimino-10-imino-N,N,6-trimethyldeca-3,4-dien-2-amine (PubChem CID 91069167) has the molecular formula C24H39N3 and a molecular weight of 369.60 g/mol. Its IUPAC name is 5-but-3-en-2-yl-8-hepta-2,6-dienylimino-10-imino-N,N,6-trimethyldeca-3,4-dien-2-amine.
| Compound Name | 5-but-3-en-2-yl-8-hepta-2,6-dienylimino-10-imino-N,N,6-trimethyldeca-3,4-dien-2-amine |
|---|---|
| PubChem CID | 91069167 |
| Molecular Formula | C24H39N3 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.31 |
| IUPAC Name | 5-but-3-en-2-yl-8-hepta-2,6-dienylimino-10-imino-N,N,6-trimethyldeca-3,4-dien-2-amine |
| SMILES | [H]/N=C/C/C(CC(C)C(=C=CC(C)N(C)C)C(C)C=C)=N\CC=CCCC=C |
| InChI | InChI=1S/C24H39N3/c1-8-10-11-12-13-18-26-23(16-17-25)19-21(4)24(20(3)9-2)15-14-22(5)27(6)7/h8-9,12-14,17,20-22,25H,1-2,10-11,16,18-19H2,3-7H3/b13-12?,25-17+,26-23+ |
| InChIKey | MWXFXLFYZDGOIE-OCJYAUMXSA-N |
| XLogP | 5.87 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|