C20H36N2 — CID 178080486
7-(4-ethylidenecyclohexyl)-5-N-pentylideneheptane-3,5-diimine (PubChem CID 178080486) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 7-(4-ethylidenecyclohexyl)-5-N-pentylideneheptane-3,5-diimine.
| Compound Name | 7-(4-ethylidenecyclohexyl)-5-N-pentylideneheptane-3,5-diimine |
|---|---|
| PubChem CID | 178080486 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 7-(4-ethylidenecyclohexyl)-5-N-pentylideneheptane-3,5-diimine |
| SMILES | [H]/N=C(\CC)CC(CCC1CCC(=CC)CC1)/N=C/CCCC |
| InChI | InChI=1S/C20H36N2/c1-4-7-8-15-22-20(16-19(21)6-3)14-13-18-11-9-17(5-2)10-12-18/h5,15,18,20-21H,4,6-14,16H2,1-3H3/b17-5-,21-19+,22-15+ |
| InChIKey | GJKSAZXXWONFRD-YWIRKGDXSA-N |
| XLogP | 6.35 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|