C10H14N2 — CID 90935757
3,4,4a,5,8,9a-hexahydrocyclohepta[b]pyridin-9-imine (PubChem CID 90935757) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 3,4,4a,5,8,9a-hexahydrocyclohepta[b]pyridin-9-imine.
| Compound Name | 3,4,4a,5,8,9a-hexahydrocyclohepta[b]pyridin-9-imine |
|---|---|
| PubChem CID | 90935757 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3,4,4a,5,8,9a-hexahydrocyclohepta[b]pyridin-9-imine |
| SMILES | [H]/N=C1\CC=CCC2CCC=NC12 |
| InChI | InChI=1S/C10H14N2/c11-9-6-2-1-4-8-5-3-7-12-10(8)9/h1-2,7-8,10-11H,3-6H2/b11-9+ |
| InChIKey | UMQYXVKMKMZLPP-PKNBQFBNSA-N |
| XLogP | 2.21 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|