C9H13N — CID 91199138
3,4,4a,7,8,8a-hexahydroquinoline (PubChem CID 91199138) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 3,4,4a,7,8,8a-hexahydroquinoline.
| Compound Name | 3,4,4a,7,8,8a-hexahydroquinoline |
|---|---|
| PubChem CID | 91199138 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 3,4,4a,7,8,8a-hexahydroquinoline |
| SMILES | C1=CC2CCC=NC2CC1 |
| InChI | InChI=1S/C9H13N/c1-2-6-9-8(4-1)5-3-7-10-9/h1,4,7-9H,2-3,5-6H2 |
| InChIKey | HODOGDKQZBDIEF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|