C9H12N2 — CID 91111457
4a,5,8,8a-tetrahydro-3H-quinolin-4-imine (PubChem CID 91111457) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 4a,5,8,8a-tetrahydro-3H-quinolin-4-imine.
| Compound Name | 4a,5,8,8a-tetrahydro-3H-quinolin-4-imine |
|---|---|
| PubChem CID | 91111457 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 4a,5,8,8a-tetrahydro-3H-quinolin-4-imine |
| SMILES | [H]/N=C1\CC=NC2CC=CCC12 |
| InChI | InChI=1S/C9H12N2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-2,6-7,9-10H,3-5H2/b10-8+ |
| InChIKey | WJIKYVATWXGWAL-CSKARUKUSA-N |
| XLogP | 1.82 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|