C8H12N2 — CID 123614959
4-ethyl-4,5-dihydroazepin-3-imine (PubChem CID 123614959) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 4-ethyl-4,5-dihydroazepin-3-imine.
| Compound Name | 4-ethyl-4,5-dihydroazepin-3-imine |
|---|---|
| PubChem CID | 123614959 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 4-ethyl-4,5-dihydroazepin-3-imine |
| SMILES | [H]/N=C1\C=NC=CCC1CC |
| InChI | InChI=1S/C8H12N2/c1-2-7-4-3-5-10-6-8(7)9/h3,5-7,9H,2,4H2,1H3/b9-8+ |
| InChIKey | JOSPBVZLHNXHFH-CMDGGOBGSA-N |
| XLogP | 2.02 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|