C13H22N2 — CID 126593497
1-N-[(E)-3-methylbut-1-enyl]-2-N-[(E)-pent-1-enyl]propane-1,2-diimine (PubChem CID 126593497) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-N-[(E)-3-methylbut-1-enyl]-2-N-[(E)-pent-1-enyl]propane-1,2-diimine.
| Compound Name | 1-N-[(E)-3-methylbut-1-enyl]-2-N-[(E)-pent-1-enyl]propane-1,2-diimine |
|---|---|
| PubChem CID | 126593497 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-N-[(E)-3-methylbut-1-enyl]-2-N-[(E)-pent-1-enyl]propane-1,2-diimine |
| SMILES | CCC/C=C/N=C(C)/C=N/C=C/C(C)C |
| InChI | InChI=1S/C13H22N2/c1-5-6-7-9-15-13(4)11-14-10-8-12(2)3/h7-12H,5-6H2,1-4H3/b9-7+,10-8+,14-11+,15-13+ |
| InChIKey | YGZLDZXBZHONQU-FQTVTVPQSA-N |
| XLogP | 4.00 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|