C8H13N — CID 142218930
4,5-dimethyl-4,5-dihydro-3H-azepine (PubChem CID 142218930) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 4,5-dimethyl-4,5-dihydro-3H-azepine.
| Compound Name | 4,5-dimethyl-4,5-dihydro-3H-azepine |
|---|---|
| PubChem CID | 142218930 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 4,5-dimethyl-4,5-dihydro-3H-azepine |
| SMILES | CC1C=CN=CCC1C |
| InChI | InChI=1S/C8H13N/c1-7-3-5-9-6-4-8(7)2/h3,5-8H,4H2,1-2H3 |
| InChIKey | DJMIYOORJBBHRL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |