C10H14FN — CID 134400234
5-but-3-enyl-7-fluoro-4,5-dihydro-3H-azepine (PubChem CID 134400234) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is 5-but-3-enyl-7-fluoro-4,5-dihydro-3H-azepine.
| Compound Name | 5-but-3-enyl-7-fluoro-4,5-dihydro-3H-azepine |
|---|---|
| PubChem CID | 134400234 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 5-but-3-enyl-7-fluoro-4,5-dihydro-3H-azepine |
| SMILES | C=CCCC1C=C(F)N=CCC1 |
| InChI | InChI=1S/C10H14FN/c1-2-3-5-9-6-4-7-12-10(11)8-9/h2,7-9H,1,3-6H2 |
| InChIKey | PLCPRILLRCAGNB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|