About 2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine
2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine (PubChem CID 90878548) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine.
Analyze 2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine?
The IUPAC name of 2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine (CID 90878548) is 2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine.
What is the SMILES notation for 2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine?
The canonical SMILES for 2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine is C1=CCC(C2C=NCCC2)N=C1.
What is the InChIKey of 2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine?
The InChIKey is RRRAJAVRAMKQAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h1-2,7-10H,3-6H2.
What are the key properties of 2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine?
2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine has a molecular weight of 162.24 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,4,5-tetrahydropyridin-5-yl)-2,3-dihydropyridine is sourced from PubChem (CID 90878548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).