C23H42N+ — CID 123398825
butylidene-[5-(3,4-dimethylhept-1-en-2-yl)-4-ethyl-2-methylcyclohex-3-en-1-yl]-methylazanium (PubChem CID 123398825) has the molecular formula C23H42N+ and a molecular weight of 332.60 g/mol. Its IUPAC name is butylidene-[5-(3,4-dimethylhept-1-en-2-yl)-4-ethyl-2-methylcyclohex-3-en-1-yl]-methylazanium.
| Compound Name | butylidene-[5-(3,4-dimethylhept-1-en-2-yl)-4-ethyl-2-methylcyclohex-3-en-1-yl]-methylazanium |
|---|---|
| PubChem CID | 123398825 |
| Molecular Formula | C23H42N+ |
| Molecular Weight | 332.60 g/mol |
| Exact Mass | 332.33 |
| IUPAC Name | butylidene-[5-(3,4-dimethylhept-1-en-2-yl)-4-ethyl-2-methylcyclohex-3-en-1-yl]-methylazanium |
| SMILES | C=C(C1CC(/[N+](C)=C/CCC)C(C)C=C1CC)C(C)C(C)CCC |
| InChI | InChI=1S/C23H42N/c1-9-12-14-24(8)23-16-22(21(11-3)15-18(23)5)20(7)19(6)17(4)13-10-2/h14-15,17-19,22-23H,7,9-13,16H2,1-6,8H3/q+1/b24-14+ |
| InChIKey | CZWYGOJMSSOXQJ-ZVHZXABRSA-N |
| XLogP | 6.49 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|