C18H36N2 — CID 123603822
12-(ethylideneamino)-N,N,10,11-tetramethyldodec-9-en-2-amine (PubChem CID 123603822) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 12-(ethylideneamino)-N,N,10,11-tetramethyldodec-9-en-2-amine.
| Compound Name | 12-(ethylideneamino)-N,N,10,11-tetramethyldodec-9-en-2-amine |
|---|---|
| PubChem CID | 123603822 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 12-(ethylideneamino)-N,N,10,11-tetramethyldodec-9-en-2-amine |
| SMILES | C/C=N/CC(C)C(C)=CCCCCCCC(C)N(C)C |
| InChI | InChI=1S/C18H36N2/c1-7-19-15-17(3)16(2)13-11-9-8-10-12-14-18(4)20(5)6/h7,13,17-18H,8-12,14-15H2,1-6H3/b16-13?,19-7+ |
| InChIKey | PAVKQYJBXJFPDX-XUAGIGDRSA-N |
| XLogP | 4.95 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|