C21H40N2 — CID 156749365
(Z)-3-(ethylideneamino)-N,N-dimethyl-6-methylidene-9-propyltridec-2-en-5-amine (PubChem CID 156749365) has the molecular formula C21H40N2 and a molecular weight of 320.56 g/mol. Its IUPAC name is (Z)-3-(ethylideneamino)-N,N-dimethyl-6-methylidene-9-propyltridec-2-en-5-amine.
| Compound Name | (Z)-3-(ethylideneamino)-N,N-dimethyl-6-methylidene-9-propyltridec-2-en-5-amine |
|---|---|
| PubChem CID | 156749365 |
| Molecular Formula | C21H40N2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.32 |
| IUPAC Name | (Z)-3-(ethylideneamino)-N,N-dimethyl-6-methylidene-9-propyltridec-2-en-5-amine |
| SMILES | C=C(CCC(CCC)CCCC)C(CC(=C/C)/N=C/C)N(C)C |
| InChI | InChI=1S/C21H40N2/c1-8-12-14-19(13-9-2)16-15-18(5)21(23(6)7)17-20(10-3)22-11-4/h10-11,19,21H,5,8-9,12-17H2,1-4,6-7H3/b20-10-,22-11+ |
| InChIKey | ULGOAYLLGVLQJQ-VPAXRDDUSA-N |
| XLogP | 6.24 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|