C24H46N2 — CID 142120672
N-[(E)-2-methyl-1-[(Z)-[(E)-3-methylhex-2-enylidene]amino]but-1-enyl]-N-propylnonan-5-amine (PubChem CID 142120672) has the molecular formula C24H46N2 and a molecular weight of 362.65 g/mol. Its IUPAC name is N-[(E)-2-methyl-1-[(Z)-[(E)-3-methylhex-2-enylidene]amino]but-1-enyl]-N-propylnonan-5-amine.
| Compound Name | N-[(E)-2-methyl-1-[(Z)-[(E)-3-methylhex-2-enylidene]amino]but-1-enyl]-N-propylnonan-5-amine |
|---|---|
| PubChem CID | 142120672 |
| Molecular Formula | C24H46N2 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 362.37 |
| IUPAC Name | N-[(E)-2-methyl-1-[(Z)-[(E)-3-methylhex-2-enylidene]amino]but-1-enyl]-N-propylnonan-5-amine |
| SMILES | CCCCC(CCCC)N(CCC)C(/N=C\C=C(/C)CCC)=C(/C)CC |
| InChI | InChI=1S/C24H46N2/c1-8-13-16-23(17-14-9-2)26(20-11-4)24(22(7)12-5)25-19-18-21(6)15-10-3/h18-19,23H,8-17,20H2,1-7H3/b21-18+,24-22-,25-19- |
| InChIKey | XCBMGAAAXATVKT-ZBMMDEAMSA-N |
| XLogP | 7.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|