C26H44N+ — CID 91077872
8-(7-bicyclo[4.1.1]octa-1(8),6-dienyl)-12-ethyl-1,5-dimethyl-1-azoniacyclopentadec-15-ene (PubChem CID 91077872) has the molecular formula C26H44N+ and a molecular weight of 370.65 g/mol. Its IUPAC name is 8-(7-bicyclo[4.1.1]octa-1(8),6-dienyl)-12-ethyl-1,5-dimethyl-1-azoniacyclopentadec-15-ene.
| Compound Name | 8-(7-bicyclo[4.1.1]octa-1(8),6-dienyl)-12-ethyl-1,5-dimethyl-1-azoniacyclopentadec-15-ene |
|---|---|
| PubChem CID | 91077872 |
| Molecular Formula | C26H44N+ |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.35 |
| IUPAC Name | 8-(7-bicyclo[4.1.1]octa-1(8),6-dienyl)-12-ethyl-1,5-dimethyl-1-azoniacyclopentadec-15-ene |
| SMILES | CCC1CC/C=[N+](/C)CCCC(C)CCC(C2=C3C=C2CCCC3)CCC1 |
| InChI | InChI=1S/C26H44N/c1-4-22-11-7-15-23(26-24-13-5-6-14-25(26)20-24)17-16-21(2)10-8-18-27(3)19-9-12-22/h19-23H,4-18H2,1-3H3/q+1/b27-19- |
| InChIKey | MXYCUOLUJUMZPQ-DIBXZPPDSA-N |
| XLogP | 7.31 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|